C13H14F3N5O3 — CID 54327090
1-(2,3-dihydroxypropyl)-3-[[2-(trifluoromethyl)quinazolin-4-yl]amino]urea (PubChem CID 54327090) has the molecular formula C13H14F3N5O3 and a molecular weight of 345.28 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-3-[[2-(trifluoromethyl)quinazolin-4-yl]amino]urea.
| Compound Name | 1-(2,3-dihydroxypropyl)-3-[[2-(trifluoromethyl)quinazolin-4-yl]amino]urea |
|---|---|
| PubChem CID | 54327090 |
| Molecular Formula | C13H14F3N5O3 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-3-[[2-(trifluoromethyl)quinazolin-4-yl]amino]urea |
| SMILES | O=C(NCC(O)CO)NNc1nc(C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C13H14F3N5O3/c14-13(15,16)11-18-9-4-2-1-3-8(9)10(19-11)20-21-12(24)17-5-7(23)6-22/h1-4,7,22-23H,5-6H2,(H2,17,21,24)(H,18,19,20) |
| InChIKey | HRTYIYUWJWEBLZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|