C26H29F3N10O2 — CID 58672454
1-[(2-methylquinazolin-4-yl)amino]-3-[1-[[[2-(trifluoromethyl)quinazolin-4-yl]amino]carbamoylamino]hexyl]urea (PubChem CID 58672454) has the molecular formula C26H29F3N10O2 and a molecular weight of 570.58 g/mol. Its IUPAC name is 1-[(2-methylquinazolin-4-yl)amino]-3-[1-[[[2-(trifluoromethyl)quinazolin-4-yl]amino]carbamoylamino]hexyl]urea.
| Compound Name | 1-[(2-methylquinazolin-4-yl)amino]-3-[1-[[[2-(trifluoromethyl)quinazolin-4-yl]amino]carbamoylamino]hexyl]urea |
|---|---|
| PubChem CID | 58672454 |
| Molecular Formula | C26H29F3N10O2 |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 1-[(2-methylquinazolin-4-yl)amino]-3-[1-[[[2-(trifluoromethyl)quinazolin-4-yl]amino]carbamoylamino]hexyl]urea |
| SMILES | CCCCCC(NC(=O)NNc1nc(C)nc2ccccc12)NC(=O)NNc1nc(C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C26H29F3N10O2/c1-3-4-5-14-20(33-24(40)38-36-21-16-10-6-8-12-18(16)30-15(2)31-21)34-25(41)39-37-22-17-11-7-9-13-19(17)32-23(35-22)26(27,28)29/h6-13,20H,3-5,14H2,1-2H3,(H,30,31,36)(H,32,35,37)(H2,33,38,40)(H2,34,39,41) |
| InChIKey | NKIYGZFWHKCHFN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 157.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|