C28H20F6N4OS — CID 143507562
(3Z)-4,4,4-trifluoro-3-[[6-(4-methylsulfanylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazinylidene]-1-phenylbutan-1-one (PubChem CID 143507562) has the molecular formula C28H20F6N4OS and a molecular weight of 574.55 g/mol. Its IUPAC name is (3Z)-4,4,4-trifluoro-3-[[6-(4-methylsulfanylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazinylidene]-1-phenylbutan-1-one.
| Compound Name | (3Z)-4,4,4-trifluoro-3-[[6-(4-methylsulfanylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazinylidene]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 143507562 |
| Molecular Formula | C28H20F6N4OS |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | (3Z)-4,4,4-trifluoro-3-[[6-(4-methylsulfanylphenyl)-5-phenyl-2-(trifluoromethyl)pyrimidin-4-yl]hydrazinylidene]-1-phenylbutan-1-one |
| SMILES | CSc1ccc(-c2nc(C(F)(F)F)nc(N/N=C(/CC(=O)c3ccccc3)C(F)(F)F)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H20F6N4OS/c1-40-20-14-12-19(13-15-20)24-23(18-10-6-3-7-11-18)25(36-26(35-24)28(32,33)34)38-37-22(27(29,30)31)16-21(39)17-8-4-2-5-9-17/h2-15H,16H2,1H3,(H,35,36,38)/b37-22- |
| InChIKey | BKNFIHXEHMSTHO-GKVNEZTPSA-N |
| XLogP | 8.15 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|