About 1-phenoxyoct-6-yn-3-one
1-phenoxyoct-6-yn-3-one (PubChem CID 104803011) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-phenoxyoct-6-yn-3-one.
Molecular Properties
| Compound Name | 1-phenoxyoct-6-yn-3-one |
| PubChem CID | 104803011 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 1-phenoxyoct-6-yn-3-one |
| SMILES | CC#CCCC(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C14H16O2/c1-2-3-5-8-13(15)11-12-16-14-9-6-4-7-10-14/h4,6-7,9-10H,5,8,11-12H2,1H3 |
| InChIKey | ILZQBJSMVPHSDJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxyoct-6-yn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxyoct-6-yn-3-one?
The IUPAC name of 1-phenoxyoct-6-yn-3-one (CID 104803011) is 1-phenoxyoct-6-yn-3-one.
What is the SMILES notation for 1-phenoxyoct-6-yn-3-one?
The canonical SMILES for 1-phenoxyoct-6-yn-3-one is CC#CCCC(=O)CCOc1ccccc1.
What is the InChIKey of 1-phenoxyoct-6-yn-3-one?
The InChIKey is ILZQBJSMVPHSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c1-2-3-5-8-13(15)11-12-16-14-9-6-4-7-10-14/h4,6-7,9-10H,5,8,11-12H2,1H3.
What are the key properties of 1-phenoxyoct-6-yn-3-one?
1-phenoxyoct-6-yn-3-one has a molecular weight of 216.28 g/mol, XLogP of 2.83, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxyoct-6-yn-3-one is sourced from PubChem (CID 104803011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).