C13H15FOS — CID 104803944
1-(3-fluorophenyl)sulfanylhept-5-yn-2-ol (PubChem CID 104803944) has the molecular formula C13H15FOS and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfanylhept-5-yn-2-ol.
| Compound Name | 1-(3-fluorophenyl)sulfanylhept-5-yn-2-ol |
|---|---|
| PubChem CID | 104803944 |
| Molecular Formula | C13H15FOS |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-(3-fluorophenyl)sulfanylhept-5-yn-2-ol |
| SMILES | CC#CCCC(O)CSc1cccc(F)c1 |
| InChI | InChI=1S/C13H15FOS/c1-2-3-4-7-12(15)10-16-13-8-5-6-11(14)9-13/h5-6,8-9,12,15H,4,7,10H2,1H3 |
| InChIKey | VXFXTYLCTLQJLA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|