C15H22N2 — CID 104807424
1-(3,5-dimethyl-2-pyridinyl)-N-ethylhex-4-yn-1-amine (PubChem CID 104807424) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-(3,5-dimethyl-2-pyridinyl)-N-ethylhex-4-yn-1-amine.
| Compound Name | 1-(3,5-dimethyl-2-pyridinyl)-N-ethylhex-4-yn-1-amine |
|---|---|
| PubChem CID | 104807424 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-(3,5-dimethyl-2-pyridinyl)-N-ethylhex-4-yn-1-amine |
| SMILES | CC#CCCC(NCC)c1ncc(C)cc1C |
| InChI | InChI=1S/C15H22N2/c1-5-7-8-9-14(16-6-2)15-13(4)10-12(3)11-17-15/h10-11,14,16H,6,8-9H2,1-4H3 |
| InChIKey | ZFFJOMRIPMPCPL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|