C15H20ClNO3 — CID 104819070
[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(2-chloro-6-methoxyphenyl)methanol (PubChem CID 104819070) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is [2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(2-chloro-6-methoxyphenyl)methanol.
| Compound Name | [2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(2-chloro-6-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 104819070 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | [2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(2-chloro-6-methoxyphenyl)methanol |
| SMILES | COc1cccc(Cl)c1C(O)C1(CN)CC2CCC1O2 |
| InChI | InChI=1S/C15H20ClNO3/c1-19-11-4-2-3-10(16)13(11)14(18)15(8-17)7-9-5-6-12(15)20-9/h2-4,9,12,14,18H,5-8,17H2,1H3 |
| InChIKey | MDIDALGGHGHAQM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |