C14H17BrFNO2 — CID 79138626
[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(5-bromo-2-fluorophenyl)methanol (PubChem CID 79138626) has the molecular formula C14H17BrFNO2 and a molecular weight of 330.20 g/mol. Its IUPAC name is [2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(5-bromo-2-fluorophenyl)methanol.
| Compound Name | [2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(5-bromo-2-fluorophenyl)methanol |
|---|---|
| PubChem CID | 79138626 |
| Molecular Formula | C14H17BrFNO2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | [2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(5-bromo-2-fluorophenyl)methanol |
| SMILES | NCC1(C(O)c2cc(Br)ccc2F)CC2CCC1O2 |
| InChI | InChI=1S/C14H17BrFNO2/c15-8-1-3-11(16)10(5-8)13(18)14(7-17)6-9-2-4-12(14)19-9/h1,3,5,9,12-13,18H,2,4,6-7,17H2 |
| InChIKey | JDQOEAGOFQOHEM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |