C14H17ClFNO2 — CID 114489214
[2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(3-chloro-2-fluorophenyl)methanol (PubChem CID 114489214) has the molecular formula C14H17ClFNO2 and a molecular weight of 285.75 g/mol. Its IUPAC name is [2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(3-chloro-2-fluorophenyl)methanol.
| Compound Name | [2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(3-chloro-2-fluorophenyl)methanol |
|---|---|
| PubChem CID | 114489214 |
| Molecular Formula | C14H17ClFNO2 |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | [2-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-(3-chloro-2-fluorophenyl)methanol |
| SMILES | NCC1(C(O)c2cccc(Cl)c2F)CC2CCC1O2 |
| InChI | InChI=1S/C14H17ClFNO2/c15-10-3-1-2-9(12(10)16)13(18)14(7-17)6-8-4-5-11(14)19-8/h1-3,8,11,13,18H,4-7,17H2 |
| InChIKey | UYMIKCFMUUJZDU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |