C11H17BrO — CID 104819666
3-(bromomethyl)-2,3-dicyclopropyloxolane (PubChem CID 104819666) has the molecular formula C11H17BrO and a molecular weight of 245.16 g/mol. Its IUPAC name is 3-(bromomethyl)-2,3-dicyclopropyloxolane.
| Compound Name | 3-(bromomethyl)-2,3-dicyclopropyloxolane |
|---|---|
| PubChem CID | 104819666 |
| Molecular Formula | C11H17BrO |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3-(bromomethyl)-2,3-dicyclopropyloxolane |
| SMILES | BrCC1(C2CC2)CCOC1C1CC1 |
| InChI | InChI=1S/C11H17BrO/c12-7-11(9-3-4-9)5-6-13-10(11)8-1-2-8/h8-10H,1-7H2 |
| InChIKey | PZBHLERDMGMEDI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|