C13H17BrOS — CID 104510783
3-(bromomethyl)-2-cyclopropyl-3-(thiophen-2-ylmethyl)oxolane (PubChem CID 104510783) has the molecular formula C13H17BrOS and a molecular weight of 301.25 g/mol. Its IUPAC name is 3-(bromomethyl)-2-cyclopropyl-3-(thiophen-2-ylmethyl)oxolane.
| Compound Name | 3-(bromomethyl)-2-cyclopropyl-3-(thiophen-2-ylmethyl)oxolane |
|---|---|
| PubChem CID | 104510783 |
| Molecular Formula | C13H17BrOS |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 3-(bromomethyl)-2-cyclopropyl-3-(thiophen-2-ylmethyl)oxolane |
| SMILES | BrCC1(Cc2cccs2)CCOC1C1CC1 |
| InChI | InChI=1S/C13H17BrOS/c14-9-13(8-11-2-1-7-16-11)5-6-15-12(13)10-3-4-10/h1-2,7,10,12H,3-6,8-9H2 |
| InChIKey | AJPDFAPFEKPMQH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|