C15H17BrCl2O — CID 107310849
3-(bromomethyl)-2-cyclopropyl-3-[(2,3-dichlorophenyl)methyl]oxolane (PubChem CID 107310849) has the molecular formula C15H17BrCl2O and a molecular weight of 364.11 g/mol. Its IUPAC name is 3-(bromomethyl)-2-cyclopropyl-3-[(2,3-dichlorophenyl)methyl]oxolane.
| Compound Name | 3-(bromomethyl)-2-cyclopropyl-3-[(2,3-dichlorophenyl)methyl]oxolane |
|---|---|
| PubChem CID | 107310849 |
| Molecular Formula | C15H17BrCl2O |
| Molecular Weight | 364.11 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 3-(bromomethyl)-2-cyclopropyl-3-[(2,3-dichlorophenyl)methyl]oxolane |
| SMILES | Clc1cccc(CC2(CBr)CCOC2C2CC2)c1Cl |
| InChI | InChI=1S/C15H17BrCl2O/c16-9-15(6-7-19-14(15)10-4-5-10)8-11-2-1-3-12(17)13(11)18/h1-3,10,14H,4-9H2 |
| InChIKey | ZJVJAIQLYMTNHN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.11 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|