C15H17Br2ClO — CID 113471676
3-[(4-bromo-2-chlorophenyl)methyl]-3-(bromomethyl)-2-cyclopropyloxolane (PubChem CID 113471676) has the molecular formula C15H17Br2ClO and a molecular weight of 408.56 g/mol. Its IUPAC name is 3-[(4-bromo-2-chlorophenyl)methyl]-3-(bromomethyl)-2-cyclopropyloxolane.
| Compound Name | 3-[(4-bromo-2-chlorophenyl)methyl]-3-(bromomethyl)-2-cyclopropyloxolane |
|---|---|
| PubChem CID | 113471676 |
| Molecular Formula | C15H17Br2ClO |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | 3-[(4-bromo-2-chlorophenyl)methyl]-3-(bromomethyl)-2-cyclopropyloxolane |
| SMILES | Clc1cc(Br)ccc1CC1(CBr)CCOC1C1CC1 |
| InChI | InChI=1S/C15H17Br2ClO/c16-9-15(5-6-19-14(15)10-1-2-10)8-11-3-4-12(17)7-13(11)18/h3-4,7,10,14H,1-2,5-6,8-9H2 |
| InChIKey | YTLZMUMTDQQMMN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|