C27H24F2N2O7 — CID 10481979
(4R,4aR,5aS,12aR)-7-(2,4-difluorophenyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 10481979) has the molecular formula C27H24F2N2O7 and a molecular weight of 526.49 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-7-(2,4-difluorophenyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-7-(2,4-difluorophenyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 10481979 |
| Molecular Formula | C27H24F2N2O7 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | (4R,4aR,5aS,12aR)-7-(2,4-difluorophenyl)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5ccc(F)cc5F)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C27H24F2N2O7/c1-31(2)21-15-8-10-7-14-12(13-4-3-11(28)9-16(13)29)5-6-17(32)19(14)22(33)18(10)24(35)27(15,38)25(36)20(23(21)34)26(30)37/h3-6,9-10,15,18,20-21,32,38H,7-8H2,1-2H3,(H2,30,37)/t10-,15-,18?,20?,21-,27-/m1/s1 |
| InChIKey | UIEIZDXVCHBXSZ-HCPSTHKVSA-N |
| XLogP | 0.81 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|