C13H14ClN3O3S — CID 104821123
N-(6-chloropyrazin-2-yl)-4-methoxy-2,6-dimethylbenzenesulfonamide (PubChem CID 104821123) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is N-(6-chloropyrazin-2-yl)-4-methoxy-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-(6-chloropyrazin-2-yl)-4-methoxy-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 104821123 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | N-(6-chloropyrazin-2-yl)-4-methoxy-2,6-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)Nc2cncc(Cl)n2)c(C)c1 |
| InChI | InChI=1S/C13H14ClN3O3S/c1-8-4-10(20-3)5-9(2)13(8)21(18,19)17-12-7-15-6-11(14)16-12/h4-7H,1-3H3,(H,16,17) |
| InChIKey | ALNALDPUVJGHNT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |