C13H16N4O3S — CID 104825782
2-amino-6-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzoic acid (PubChem CID 104825782) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-amino-6-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzoic acid.
| Compound Name | 2-amino-6-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 104825782 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-amino-6-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzoic acid |
| SMILES | CCCn1c(SCc2cccc(N)c2C(=O)O)n[nH]c1=O |
| InChI | InChI=1S/C13H16N4O3S/c1-2-6-17-12(20)15-16-13(17)21-7-8-4-3-5-9(14)10(8)11(18)19/h3-5H,2,6-7,14H2,1H3,(H,15,20)(H,18,19) |
| InChIKey | BKHPPKQLVVQOQC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|