C12H19IN2 — CID 104827380
1-N-(3,3-dimethylbutan-2-yl)-4-iodobenzene-1,2-diamine (PubChem CID 104827380) has the molecular formula C12H19IN2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 1-N-(3,3-dimethylbutan-2-yl)-4-iodobenzene-1,2-diamine.
| Compound Name | 1-N-(3,3-dimethylbutan-2-yl)-4-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 104827380 |
| Molecular Formula | C12H19IN2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-N-(3,3-dimethylbutan-2-yl)-4-iodobenzene-1,2-diamine |
| SMILES | CC(Nc1ccc(I)cc1N)C(C)(C)C |
| InChI | InChI=1S/C12H19IN2/c1-8(12(2,3)4)15-11-6-5-9(13)7-10(11)14/h5-8,15H,14H2,1-4H3 |
| InChIKey | NYUCMAKDIAQASS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|