C11H17IN2O2S — CID 79558463
4-iodo-1-N-(2-methyl-2-methylsulfonylpropyl)benzene-1,2-diamine (PubChem CID 79558463) has the molecular formula C11H17IN2O2S and a molecular weight of 368.24 g/mol. Its IUPAC name is 4-iodo-1-N-(2-methyl-2-methylsulfonylpropyl)benzene-1,2-diamine.
| Compound Name | 4-iodo-1-N-(2-methyl-2-methylsulfonylpropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 79558463 |
| Molecular Formula | C11H17IN2O2S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 4-iodo-1-N-(2-methyl-2-methylsulfonylpropyl)benzene-1,2-diamine |
| SMILES | CC(C)(CNc1ccc(I)cc1N)S(C)(=O)=O |
| InChI | InChI=1S/C11H17IN2O2S/c1-11(2,17(3,15)16)7-14-10-5-4-8(12)6-9(10)13/h4-6,14H,7,13H2,1-3H3 |
| InChIKey | NITWNZGICZHKEF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|