C10H13IN2 — CID 131242821
1-N-[(E)-but-2-enyl]-4-iodobenzene-1,2-diamine (PubChem CID 131242821) has the molecular formula C10H13IN2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 1-N-[(E)-but-2-enyl]-4-iodobenzene-1,2-diamine.
| Compound Name | 1-N-[(E)-but-2-enyl]-4-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 131242821 |
| Molecular Formula | C10H13IN2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 1-N-[(E)-but-2-enyl]-4-iodobenzene-1,2-diamine |
| SMILES | C/C=C/CNc1ccc(I)cc1N |
| InChI | InChI=1S/C10H13IN2/c1-2-3-6-13-10-5-4-8(11)7-9(10)12/h2-5,7,13H,6,12H2,1H3/b3-2+ |
| InChIKey | GKAQMGRSSCSEEQ-NSCUHMNNSA-N |
| XLogP | 2.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|