C12H26N2 — CID 104830208
1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine (PubChem CID 104830208) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine.
| Compound Name | 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine |
|---|---|
| PubChem CID | 104830208 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine |
| SMILES | CC(N1CCNC(C)(C)C1)C(C)(C)C |
| InChI | InChI=1S/C12H26N2/c1-10(11(2,3)4)14-8-7-13-12(5,6)9-14/h10,13H,7-9H2,1-6H3 |
| InChIKey | SOZCFFHBCGQCKZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |