About 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine
1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine (PubChem CID 104830208) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine |
| PubChem CID | 104830208 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine |
| SMILES | CC(N1CCNC(C)(C)C1)C(C)(C)C |
| InChI | InChI=1S/C12H26N2/c1-10(11(2,3)4)14-8-7-13-12(5,6)9-14/h10,13H,7-9H2,1-6H3 |
| InChIKey | SOZCFFHBCGQCKZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine?
The IUPAC name of 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine (CID 104830208) is 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine.
What is the SMILES notation for 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine?
The canonical SMILES for 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine is CC(N1CCNC(C)(C)C1)C(C)(C)C.
What is the InChIKey of 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine?
The InChIKey is SOZCFFHBCGQCKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-10(11(2,3)4)14-8-7-13-12(5,6)9-14/h10,13H,7-9H2,1-6H3.
What are the key properties of 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine?
1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine has a molecular weight of 198.35 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbutan-2-yl)-3,3-dimethylpiperazine is sourced from PubChem (CID 104830208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).