C15H12BrNO4 — CID 104832973
3-[[2-(3-bromophenyl)acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 104832973) has the molecular formula C15H12BrNO4 and a molecular weight of 350.17 g/mol. Its IUPAC name is 3-[[2-(3-bromophenyl)acetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 3-[[2-(3-bromophenyl)acetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 104832973 |
| Molecular Formula | C15H12BrNO4 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 3-[[2-(3-bromophenyl)acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Cc1cccc(Br)c1)Nc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C15H12BrNO4/c16-10-4-1-3-9(7-10)8-13(18)17-12-6-2-5-11(14(12)19)15(20)21/h1-7,19H,8H2,(H,17,18)(H,20,21) |
| InChIKey | QKMAYCOSDVCRGP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|