C14H14N2O5 — CID 104833014
3-[(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)amino]-2-hydroxybenzoic acid (PubChem CID 104833014) has the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. Its IUPAC name is 3-[(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 3-[(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 104833014 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-[(3-ethyl-5-methyl-1,2-oxazole-4-carbonyl)amino]-2-hydroxybenzoic acid |
| SMILES | CCc1noc(C)c1C(=O)Nc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C14H14N2O5/c1-3-9-11(7(2)21-16-9)13(18)15-10-6-4-5-8(12(10)17)14(19)20/h4-6,17H,3H2,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | DWTXQNNKJSZRIX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|