C13H12Cl2N2O2 — CID 17173585
N-(2,3-dichlorophenyl)-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 17173585) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 17173585 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-(2,3-dichlorophenyl)-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1noc(C)c1C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl2N2O2/c1-3-9-11(7(2)19-17-9)13(18)16-10-6-4-5-8(14)12(10)15/h4-6H,3H2,1-2H3,(H,16,18) |
| InChIKey | KUHHJNZFGFJKSI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |