C20H20N2O2 — CID 8023443
N-(2-benzylphenyl)-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 8023443) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-(2-benzylphenyl)-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(2-benzylphenyl)-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 8023443 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-(2-benzylphenyl)-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1noc(C)c1C(=O)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2O2/c1-3-17-19(14(2)24-22-17)20(23)21-18-12-8-7-11-16(18)13-15-9-5-4-6-10-15/h4-12H,3,13H2,1-2H3,(H,21,23) |
| InChIKey | LWBSBFZGZWVRBJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |