C17H19NO3 — CID 14128614
N-(2-ethylphenyl)-2,5,6-trimethyl-4-oxopyran-3-carboxamide (PubChem CID 14128614) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2,5,6-trimethyl-4-oxopyran-3-carboxamide.
| Compound Name | N-(2-ethylphenyl)-2,5,6-trimethyl-4-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 14128614 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-(2-ethylphenyl)-2,5,6-trimethyl-4-oxopyran-3-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1c(C)oc(C)c(C)c1=O |
| InChI | InChI=1S/C17H19NO3/c1-5-13-8-6-7-9-14(13)18-17(20)15-12(4)21-11(3)10(2)16(15)19/h6-9H,5H2,1-4H3,(H,18,20) |
| InChIKey | WCBKUVFEYYKXDT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |