C11H8ClN3S2 — CID 104836355
7-chloro-3-(1,3-thiazol-2-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 104836355) has the molecular formula C11H8ClN3S2 and a molecular weight of 281.79 g/mol. Its IUPAC name is 7-chloro-3-(1,3-thiazol-2-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 7-chloro-3-(1,3-thiazol-2-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 104836355 |
| Molecular Formula | C11H8ClN3S2 |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 7-chloro-3-(1,3-thiazol-2-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | S=c1[nH]c2c(Cl)cccc2n1Cc1nccs1 |
| InChI | InChI=1S/C11H8ClN3S2/c12-7-2-1-3-8-10(7)14-11(16)15(8)6-9-13-4-5-17-9/h1-5H,6H2,(H,14,16) |
| InChIKey | RIRVWLCQHFQHTK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|