C12H10ClN3S2 — CID 113458951
7-chloro-3-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 113458951) has the molecular formula C12H10ClN3S2 and a molecular weight of 295.82 g/mol. Its IUPAC name is 7-chloro-3-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 7-chloro-3-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 113458951 |
| Molecular Formula | C12H10ClN3S2 |
| Molecular Weight | 295.82 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 7-chloro-3-[(2-methyl-1,3-thiazol-5-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1ncc(Cn2c(=S)[nH]c3c(Cl)cccc32)s1 |
| InChI | InChI=1S/C12H10ClN3S2/c1-7-14-5-8(18-7)6-16-10-4-2-3-9(13)11(10)15-12(16)17/h2-5H,6H2,1H3,(H,15,17) |
| InChIKey | HDKCCOZXRIEKEW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.82 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|