C11H8ClN3OS — CID 104836587
7-chloro-3-(1,2-oxazol-3-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 104836587) has the molecular formula C11H8ClN3OS and a molecular weight of 265.73 g/mol. Its IUPAC name is 7-chloro-3-(1,2-oxazol-3-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 7-chloro-3-(1,2-oxazol-3-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 104836587 |
| Molecular Formula | C11H8ClN3OS |
| Molecular Weight | 265.73 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 7-chloro-3-(1,2-oxazol-3-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | S=c1[nH]c2c(Cl)cccc2n1Cc1ccon1 |
| InChI | InChI=1S/C11H8ClN3OS/c12-8-2-1-3-9-10(8)13-11(17)15(9)6-7-4-5-16-14-7/h1-5H,6H2,(H,13,17) |
| InChIKey | COLNJLBWHXHABP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.73 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|