C39H39N5O3 — CID 10484081
(1-tritylimidazol-4-yl)methyl N-[3-(1H-indol-3-yl)-1-(2-methylpropylamino)-1-oxopropan-2-yl]carbamate (PubChem CID 10484081) has the molecular formula C39H39N5O3 and a molecular weight of 625.77 g/mol. Its IUPAC name is (1-tritylimidazol-4-yl)methyl N-[3-(1H-indol-3-yl)-1-(2-methylpropylamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | (1-tritylimidazol-4-yl)methyl N-[3-(1H-indol-3-yl)-1-(2-methylpropylamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10484081 |
| Molecular Formula | C39H39N5O3 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.31 |
| IUPAC Name | (1-tritylimidazol-4-yl)methyl N-[3-(1H-indol-3-yl)-1-(2-methylpropylamino)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)CNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)OCc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C39H39N5O3/c1-28(2)23-41-37(45)36(22-29-24-40-35-21-13-12-20-34(29)35)43-38(46)47-26-33-25-44(27-42-33)39(30-14-6-3-7-15-30,31-16-8-4-9-17-31)32-18-10-5-11-19-32/h3-21,24-25,27-28,36,40H,22-23,26H2,1-2H3,(H,41,45)(H,43,46) |
| InChIKey | BHZNWCVELYRWOJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|