C9H11IN4O — CID 104844062
4-(5-iodopyrimidin-2-yl)-3-methylpiperazin-2-one (PubChem CID 104844062) has the molecular formula C9H11IN4O and a molecular weight of 318.12 g/mol. Its IUPAC name is 4-(5-iodopyrimidin-2-yl)-3-methylpiperazin-2-one.
| Compound Name | 4-(5-iodopyrimidin-2-yl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 104844062 |
| Molecular Formula | C9H11IN4O |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 4-(5-iodopyrimidin-2-yl)-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1c1ncc(I)cn1 |
| InChI | InChI=1S/C9H11IN4O/c1-6-8(15)11-2-3-14(6)9-12-4-7(10)5-13-9/h4-6H,2-3H2,1H3,(H,11,15) |
| InChIKey | MLMRETILTJFLDO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|