C9H13N5O — CID 80652532
4-(5-aminopyrazin-2-yl)-3-methylpiperazin-2-one (PubChem CID 80652532) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 4-(5-aminopyrazin-2-yl)-3-methylpiperazin-2-one.
| Compound Name | 4-(5-aminopyrazin-2-yl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 80652532 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 4-(5-aminopyrazin-2-yl)-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1c1cnc(N)cn1 |
| InChI | InChI=1S/C9H13N5O/c1-6-9(15)11-2-3-14(6)8-5-12-7(10)4-13-8/h4-6H,2-3H2,1H3,(H2,10,12)(H,11,15) |
| InChIKey | HKTPJLANUVEJFP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |