C11H13N5O2 — CID 63595617
4-(7-amino-2,1,3-benzoxadiazol-4-yl)-3-methylpiperazin-2-one (PubChem CID 63595617) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-(7-amino-2,1,3-benzoxadiazol-4-yl)-3-methylpiperazin-2-one.
| Compound Name | 4-(7-amino-2,1,3-benzoxadiazol-4-yl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 63595617 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-(7-amino-2,1,3-benzoxadiazol-4-yl)-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1c1ccc(N)c2nonc12 |
| InChI | InChI=1S/C11H13N5O2/c1-6-11(17)13-4-5-16(6)8-3-2-7(12)9-10(8)15-18-14-9/h2-3,6H,4-5,12H2,1H3,(H,13,17) |
| InChIKey | UOHCPINXEHXDSU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|