About 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine
4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine (PubChem CID 16640650) has the molecular formula C12H16N4O
and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine.
Molecular Properties
| Compound Name | 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine |
| PubChem CID | 16640650 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine |
| SMILES | Nc1ccc(N2CCCCCC2)c2nonc12 |
| InChI | InChI=1S/C12H16N4O/c13-9-5-6-10(12-11(9)14-17-15-12)16-7-3-1-2-4-8-16/h5-6H,1-4,7-8,13H2 |
| InChIKey | JQSXJDAYPWALCR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine?
The IUPAC name of 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine (CID 16640650) is 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine.
What is the SMILES notation for 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine?
The canonical SMILES for 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine is Nc1ccc(N2CCCCCC2)c2nonc12.
What is the InChIKey of 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine?
The InChIKey is JQSXJDAYPWALCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O/c13-9-5-6-10(12-11(9)14-17-15-12)16-7-3-1-2-4-8-16/h5-6H,1-4,7-8,13H2.
What are the key properties of 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine?
4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine has a molecular weight of 232.29 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azepan-1-yl)-2,1,3-benzoxadiazol-7-amine is sourced from PubChem (CID 16640650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).