C14H21N5O — CID 62774227
4-(4-butan-2-ylpiperazin-1-yl)-2,1,3-benzoxadiazol-7-amine (PubChem CID 62774227) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-(4-butan-2-ylpiperazin-1-yl)-2,1,3-benzoxadiazol-7-amine.
| Compound Name | 4-(4-butan-2-ylpiperazin-1-yl)-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 62774227 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-(4-butan-2-ylpiperazin-1-yl)-2,1,3-benzoxadiazol-7-amine |
| SMILES | CCC(C)N1CCN(c2ccc(N)c3nonc23)CC1 |
| InChI | InChI=1S/C14H21N5O/c1-3-10(2)18-6-8-19(9-7-18)12-5-4-11(15)13-14(12)17-20-16-13/h4-5,10H,3,6-9,15H2,1-2H3 |
| InChIKey | NHNSXKLPJUNJEL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|