C12H17N5O — CID 55160863
4-[3-(dimethylamino)pyrrolidin-1-yl]-2,1,3-benzoxadiazol-7-amine (PubChem CID 55160863) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 4-[3-(dimethylamino)pyrrolidin-1-yl]-2,1,3-benzoxadiazol-7-amine.
| Compound Name | 4-[3-(dimethylamino)pyrrolidin-1-yl]-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 55160863 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 4-[3-(dimethylamino)pyrrolidin-1-yl]-2,1,3-benzoxadiazol-7-amine |
| SMILES | CN(C)C1CCN(c2ccc(N)c3nonc23)C1 |
| InChI | InChI=1S/C12H17N5O/c1-16(2)8-5-6-17(7-8)10-4-3-9(13)11-12(10)15-18-14-11/h3-4,8H,5-7,13H2,1-2H3 |
| InChIKey | NLLWEEGHEKJXBH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|