C14H20N4O — CID 56879526
4-(4-cyclobutyl-6-methylpyrimidin-2-yl)-3-methylpiperazin-2-one (PubChem CID 56879526) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-(4-cyclobutyl-6-methylpyrimidin-2-yl)-3-methylpiperazin-2-one.
| Compound Name | 4-(4-cyclobutyl-6-methylpyrimidin-2-yl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 56879526 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 4-(4-cyclobutyl-6-methylpyrimidin-2-yl)-3-methylpiperazin-2-one |
| SMILES | Cc1cc(C2CCC2)nc(N2CCNC(=O)C2C)n1 |
| InChI | InChI=1S/C14H20N4O/c1-9-8-12(11-4-3-5-11)17-14(16-9)18-7-6-15-13(19)10(18)2/h8,10-11H,3-7H2,1-2H3,(H,15,19) |
| InChIKey | UDNAABAIXLPQFT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |