C17H15FN2 — CID 104847016
5-fluoro-3,8-dimethyl-2-phenylquinolin-4-amine (PubChem CID 104847016) has the molecular formula C17H15FN2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 5-fluoro-3,8-dimethyl-2-phenylquinolin-4-amine.
| Compound Name | 5-fluoro-3,8-dimethyl-2-phenylquinolin-4-amine |
|---|---|
| PubChem CID | 104847016 |
| Molecular Formula | C17H15FN2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 5-fluoro-3,8-dimethyl-2-phenylquinolin-4-amine |
| SMILES | Cc1c(-c2ccccc2)nc2c(C)ccc(F)c2c1N |
| InChI | InChI=1S/C17H15FN2/c1-10-8-9-13(18)14-15(19)11(2)17(20-16(10)14)12-6-4-3-5-7-12/h3-9H,1-2H3,(H2,19,20) |
| InChIKey | NADBJQUTADFFSC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |