C18H17FN2 — CID 104847019
8-fluoro-N,3,6-trimethyl-2-phenylquinolin-4-amine (PubChem CID 104847019) has the molecular formula C18H17FN2 and a molecular weight of 280.35 g/mol. Its IUPAC name is 8-fluoro-N,3,6-trimethyl-2-phenylquinolin-4-amine.
| Compound Name | 8-fluoro-N,3,6-trimethyl-2-phenylquinolin-4-amine |
|---|---|
| PubChem CID | 104847019 |
| Molecular Formula | C18H17FN2 |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 8-fluoro-N,3,6-trimethyl-2-phenylquinolin-4-amine |
| SMILES | CNc1c(C)c(-c2ccccc2)nc2c(F)cc(C)cc12 |
| InChI | InChI=1S/C18H17FN2/c1-11-9-14-17(20-3)12(2)16(13-7-5-4-6-8-13)21-18(14)15(19)10-11/h4-10H,1-3H3,(H,20,21) |
| InChIKey | STZAFURPVLITGH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |