C16H10ClF2N — CID 104846013
4-chloro-7,8-difluoro-3-methyl-2-phenylquinoline (PubChem CID 104846013) has the molecular formula C16H10ClF2N and a molecular weight of 289.71 g/mol. Its IUPAC name is 4-chloro-7,8-difluoro-3-methyl-2-phenylquinoline.
| Compound Name | 4-chloro-7,8-difluoro-3-methyl-2-phenylquinoline |
|---|---|
| PubChem CID | 104846013 |
| Molecular Formula | C16H10ClF2N |
| Molecular Weight | 289.71 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-chloro-7,8-difluoro-3-methyl-2-phenylquinoline |
| SMILES | Cc1c(-c2ccccc2)nc2c(F)c(F)ccc2c1Cl |
| InChI | InChI=1S/C16H10ClF2N/c1-9-13(17)11-7-8-12(18)14(19)16(11)20-15(9)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | IVQKXYRDVUKQTB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.71 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |