C44H44O10 — CID 10485103
[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxan-2-yl]methyl benzoate (PubChem CID 10485103) has the molecular formula C44H44O10 and a molecular weight of 732.83 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10485103 |
| Molecular Formula | C44H44O10 |
| Molecular Weight | 732.83 g/mol |
| Exact Mass | 732.29 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxan-2-yl]methyl benzoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](O[C@@H]1O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]1OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C44H44O10/c1-43(2)32-24-25-44(43,3)34(26-32)51-42-37(54-41(48)31-22-14-7-15-23-31)36(53-40(47)30-20-12-6-13-21-30)35(52-39(46)29-18-10-5-11-19-29)33(50-42)27-49-38(45)28-16-8-4-9-17-28/h4-23,32-37,42H,24-27H2,1-3H3/t32-,33+,34+,35+,36-,37+,42-,44+/m0/s1 |
| InChIKey | RNUQNQJYAQIKPL-BCXOIKPLSA-N |
| XLogP | 7.48 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.83 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|