C44H40Br4O10 — CID 10034057
[(2R,3R,4S,5R,6R)-3,4,5-tris[(4-bromobenzoyl)oxy]-6-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxan-2-yl]methyl 4-bromobenzoate (PubChem CID 10034057) has the molecular formula C44H40Br4O10 and a molecular weight of 1048.41 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tris[(4-bromobenzoyl)oxy]-6-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxan-2-yl]methyl 4-bromobenzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tris[(4-bromobenzoyl)oxy]-6-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxan-2-yl]methyl 4-bromobenzoate |
|---|---|
| PubChem CID | 10034057 |
| Molecular Formula | C44H40Br4O10 |
| Molecular Weight | 1048.41 g/mol |
| Exact Mass | 1043.94 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tris[(4-bromobenzoyl)oxy]-6-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxan-2-yl]methyl 4-bromobenzoate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O[C@@H]1O[C@H](COC(=O)c3ccc(Br)cc3)[C@@H](OC(=O)c3ccc(Br)cc3)[C@H](OC(=O)c3ccc(Br)cc3)[C@H]1OC(=O)c1ccc(Br)cc1)C2 |
| InChI | InChI=1S/C44H40Br4O10/c1-43(2)28-20-21-44(43,3)34(22-28)55-42-37(58-41(52)27-10-18-32(48)19-11-27)36(57-40(51)26-8-16-31(47)17-9-26)35(56-39(50)25-6-14-30(46)15-7-25)33(54-42)23-53-38(49)24-4-12-29(45)13-5-24/h4-19,28,33-37,42H,20-23H2,1-3H3/t28-,33-,34+,35-,36+,37-,42+,44+/m1/s1 |
| InChIKey | KCKASXXPCRJXCS-BKBNKTNFSA-N |
| XLogP | 10.53 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1048.41 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|