C13H25NS — CID 104854149
3,4-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclohexan-1-amine (PubChem CID 104854149) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is 3,4-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclohexan-1-amine.
| Compound Name | 3,4-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 104854149 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 3,4-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclohexan-1-amine |
| SMILES | C=CCSCCNC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C13H25NS/c1-4-8-15-9-7-14-13-6-5-11(2)12(3)10-13/h4,11-14H,1,5-10H2,2-3H3 |
| InChIKey | JKUJIULXOSDIHJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|