C9H9F3N4O2S — CID 104854461
5-nitro-N-(4,4,4-trifluorobutan-2-yl)imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 104854461) has the molecular formula C9H9F3N4O2S and a molecular weight of 294.26 g/mol. Its IUPAC name is 5-nitro-N-(4,4,4-trifluorobutan-2-yl)imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-nitro-N-(4,4,4-trifluorobutan-2-yl)imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 104854461 |
| Molecular Formula | C9H9F3N4O2S |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 5-nitro-N-(4,4,4-trifluorobutan-2-yl)imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CC(CC(F)(F)F)Nc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9F3N4O2S/c1-5(4-9(10,11)12)13-6-7(16(17)18)15-2-3-19-8(15)14-6/h2-3,5,13H,4H2,1H3 |
| InChIKey | WIQLVYDHPKSXAF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|