C6H8F2N4O2 — CID 104857347
N-(2,2-difluoro-3-hydroxypropyl)-2H-triazole-4-carboxamide (PubChem CID 104857347) has the molecular formula C6H8F2N4O2 and a molecular weight of 206.15 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-2H-triazole-4-carboxamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 104857347 |
| Molecular Formula | C6H8F2N4O2 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-2H-triazole-4-carboxamide |
| SMILES | O=C(NCC(F)(F)CO)c1cn[nH]n1 |
| InChI | InChI=1S/C6H8F2N4O2/c7-6(8,3-13)2-9-5(14)4-1-10-12-11-4/h1,13H,2-3H2,(H,9,14)(H,10,11,12) |
| InChIKey | VPQNPWUFKWEFIR-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |