C10H15N5O2 — CID 112686233
N-(2-oxo-2-piperidin-1-ylethyl)-2H-triazole-4-carboxamide (PubChem CID 112686233) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is N-(2-oxo-2-piperidin-1-ylethyl)-2H-triazole-4-carboxamide.
| Compound Name | N-(2-oxo-2-piperidin-1-ylethyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 112686233 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-(2-oxo-2-piperidin-1-ylethyl)-2H-triazole-4-carboxamide |
| SMILES | O=C(NCC(=O)N1CCCCC1)c1cn[nH]n1 |
| InChI | InChI=1S/C10H15N5O2/c16-9(15-4-2-1-3-5-15)7-11-10(17)8-6-12-14-13-8/h6H,1-5,7H2,(H,11,17)(H,12,13,14) |
| InChIKey | GPWLTPFKZZLSNV-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |