C11H11Cl2F2NO3 — CID 104858144
2-(2,5-dichlorophenoxy)-N-(2,2-difluoro-3-hydroxypropyl)acetamide (PubChem CID 104858144) has the molecular formula C11H11Cl2F2NO3 and a molecular weight of 314.12 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-(2,2-difluoro-3-hydroxypropyl)acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-(2,2-difluoro-3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 104858144 |
| Molecular Formula | C11H11Cl2F2NO3 |
| Molecular Weight | 314.12 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-(2,2-difluoro-3-hydroxypropyl)acetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)NCC(F)(F)CO |
| InChI | InChI=1S/C11H11Cl2F2NO3/c12-7-1-2-8(13)9(3-7)19-4-10(18)16-5-11(14,15)6-17/h1-3,17H,4-6H2,(H,16,18) |
| InChIKey | PBUHFXDIIKHGQJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.12 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |