C9H17F3N2S — CID 104859012
1-(2-methylpropyl)-3-(4,4,4-trifluorobutan-2-yl)thiourea (PubChem CID 104859012) has the molecular formula C9H17F3N2S and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-(4,4,4-trifluorobutan-2-yl)thiourea.
| Compound Name | 1-(2-methylpropyl)-3-(4,4,4-trifluorobutan-2-yl)thiourea |
|---|---|
| PubChem CID | 104859012 |
| Molecular Formula | C9H17F3N2S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-(2-methylpropyl)-3-(4,4,4-trifluorobutan-2-yl)thiourea |
| SMILES | CC(C)CNC(=S)NC(C)CC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2S/c1-6(2)5-13-8(15)14-7(3)4-9(10,11)12/h6-7H,4-5H2,1-3H3,(H2,13,14,15) |
| InChIKey | OCNPLADQCRQNPR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|