C12H22ClN5O — CID 104862069
3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl-propan-2-ylamino]-N'-hydroxypropanimidamide (PubChem CID 104862069) has the molecular formula C12H22ClN5O and a molecular weight of 287.80 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl-propan-2-ylamino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl-propan-2-ylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 104862069 |
| Molecular Formula | C12H22ClN5O |
| Molecular Weight | 287.80 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl-propan-2-ylamino]-N'-hydroxypropanimidamide |
| SMILES | Cc1nn(C)c(Cl)c1CN(CCC(N)=NO)C(C)C |
| InChI | InChI=1S/C12H22ClN5O/c1-8(2)18(6-5-11(14)16-19)7-10-9(3)15-17(4)12(10)13/h8,19H,5-7H2,1-4H3,(H2,14,16) |
| InChIKey | GQCYGMILUFTURK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.80 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|