C11H19ClN4S — CID 113469983
3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl-ethylamino]propanethioamide (PubChem CID 113469983) has the molecular formula C11H19ClN4S and a molecular weight of 274.82 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl-ethylamino]propanethioamide.
| Compound Name | 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl-ethylamino]propanethioamide |
|---|---|
| PubChem CID | 113469983 |
| Molecular Formula | C11H19ClN4S |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl-ethylamino]propanethioamide |
| SMILES | CCN(CCC(N)=S)Cc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C11H19ClN4S/c1-4-16(6-5-10(13)17)7-9-8(2)14-15(3)11(9)12/h4-7H2,1-3H3,(H2,13,17) |
| InChIKey | YEITZBILTMRZRN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|