About N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine
N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine (PubChem CID 60795956) has the molecular formula C14H26ClN3
and a molecular weight of 271.84 g/mol. Its IUPAC name is N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine.
Molecular Properties
| Compound Name | N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine |
| PubChem CID | 60795956 |
| Molecular Formula | C14H26ClN3 |
| Molecular Weight | 271.84 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine |
| SMILES | CCCCN(CCCC)Cc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C14H26ClN3/c1-5-7-9-18(10-8-6-2)11-13-12(3)16-17(4)14(13)15/h5-11H2,1-4H3 |
| InChIKey | FJXRJRBQBITQQU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine?
The IUPAC name of N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine (CID 60795956) is N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine.
What is the SMILES notation for N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine?
The canonical SMILES for N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine is CCCCN(CCCC)Cc1c(C)nn(C)c1Cl.
What is the InChIKey of N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine?
The InChIKey is FJXRJRBQBITQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26ClN3/c1-5-7-9-18(10-8-6-2)11-13-12(3)16-17(4)14(13)15/h5-11H2,1-4H3.
What are the key properties of N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine?
N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine has a molecular weight of 271.84 g/mol, XLogP of 3.78, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine is sourced from PubChem (CID 60795956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).